C20H39N3O2 — CID 176578664
3-methyl-1-[4-[1-[2-(propan-2-ylamino)ethyl]piperidin-4-yl]oxypiperidin-1-yl]butan-2-one (PubChem CID 176578664) has the molecular formula C20H39N3O2 and a molecular weight of 353.55 g/mol. Its IUPAC name is 3-methyl-1-[4-[1-[2-(propan-2-ylamino)ethyl]piperidin-4-yl]oxypiperidin-1-yl]butan-2-one.
| Compound Name | 3-methyl-1-[4-[1-[2-(propan-2-ylamino)ethyl]piperidin-4-yl]oxypiperidin-1-yl]butan-2-one |
|---|---|
| PubChem CID | 176578664 |
| Molecular Formula | C20H39N3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | 3-methyl-1-[4-[1-[2-(propan-2-ylamino)ethyl]piperidin-4-yl]oxypiperidin-1-yl]butan-2-one |
| SMILES | CC(C)NCCN1CCC(OC2CCN(CC(=O)C(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H39N3O2/c1-16(2)20(24)15-23-12-7-19(8-13-23)25-18-5-10-22(11-6-18)14-9-21-17(3)4/h16-19,21H,5-15H2,1-4H3 |
| InChIKey | ZVGVHAXENVHORQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |