C16H11N5O2S3 — CID 176578701
6-[[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]amino]pyridazine-3-carboxylic acid (PubChem CID 176578701) has the molecular formula C16H11N5O2S3 and a molecular weight of 401.50 g/mol. Its IUPAC name is 6-[[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]amino]pyridazine-3-carboxylic acid.
| Compound Name | 6-[[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]amino]pyridazine-3-carboxylic acid |
|---|---|
| PubChem CID | 176578701 |
| Molecular Formula | C16H11N5O2S3 |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 6-[[6-(thiophen-2-ylsulfanylamino)-1,3-benzothiazol-2-yl]amino]pyridazine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(Nc2nc3ccc(NSc4cccs4)cc3s2)nn1 |
| InChI | InChI=1S/C16H11N5O2S3/c22-15(23)11-5-6-13(20-19-11)18-16-17-10-4-3-9(8-12(10)25-16)21-26-14-2-1-7-24-14/h1-8,21H,(H,22,23)(H,17,18,20) |
| InChIKey | VXVPVMJNCTXZDK-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 100.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|