C18H24FNO3 — CID 176579432
3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoic acid;ethane (PubChem CID 176579432) has the molecular formula C18H24FNO3 and a molecular weight of 321.39 g/mol. Its IUPAC name is 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoic acid;ethane.
| Compound Name | 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoic acid;ethane |
|---|---|
| PubChem CID | 176579432 |
| Molecular Formula | C18H24FNO3 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | 3-[1-(cyclopropanecarbonyl)piperidin-4-yl]-2-fluorobenzoic acid;ethane |
| SMILES | CC.O=C(O)c1cccc(C2CCN(C(=O)C3CC3)CC2)c1F |
| InChI | InChI=1S/C16H18FNO3.C2H6/c17-14-12(2-1-3-13(14)16(20)21)10-6-8-18(9-7-10)15(19)11-4-5-11;1-2/h1-3,10-11H,4-9H2,(H,20,21);1-2H3 |
| InChIKey | YYCJBLIGGKMVHF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |