C24H32F2N2O3 — CID 176579457
N-[(1R)-1-cyclohexyl-2-oxopropyl]-3-[1-(2,2-difluoropropanoyl)piperidin-3-yl]benzamide (PubChem CID 176579457) has the molecular formula C24H32F2N2O3 and a molecular weight of 434.53 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexyl-2-oxopropyl]-3-[1-(2,2-difluoropropanoyl)piperidin-3-yl]benzamide.
| Compound Name | N-[(1R)-1-cyclohexyl-2-oxopropyl]-3-[1-(2,2-difluoropropanoyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 176579457 |
| Molecular Formula | C24H32F2N2O3 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | N-[(1R)-1-cyclohexyl-2-oxopropyl]-3-[1-(2,2-difluoropropanoyl)piperidin-3-yl]benzamide |
| SMILES | CC(=O)[C@H](NC(=O)c1cccc(C2CCCN(C(=O)C(C)(F)F)C2)c1)C1CCCCC1 |
| InChI | InChI=1S/C24H32F2N2O3/c1-16(29)21(17-8-4-3-5-9-17)27-22(30)19-11-6-10-18(14-19)20-12-7-13-28(15-20)23(31)24(2,25)26/h6,10-11,14,17,20-21H,3-5,7-9,12-13,15H2,1-2H3,(H,27,30)/t20?,21-/m0/s1 |
| InChIKey | ZTSRYTBXKGVRIN-LBAQZLPGSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |