C26H36N2O3 — CID 176575682
N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(cyclopropanecarbonyl)piperidin-3-yl]benzamide (PubChem CID 176575682) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(cyclopropanecarbonyl)piperidin-3-yl]benzamide.
| Compound Name | N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(cyclopropanecarbonyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 176575682 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(cyclopropanecarbonyl)piperidin-3-yl]benzamide |
| SMILES | CCC(=O)[C@H](NC(=O)c1cccc(C2CCCN(C(=O)C3CC3)C2)c1)C1CCCCC1 |
| InChI | InChI=1S/C26H36N2O3/c1-2-23(29)24(18-8-4-3-5-9-18)27-25(30)21-11-6-10-20(16-21)22-12-7-15-28(17-22)26(31)19-13-14-19/h6,10-11,16,18-19,22,24H,2-5,7-9,12-15,17H2,1H3,(H,27,30)/t22?,24-/m1/s1 |
| InChIKey | HKQOWNQCTVSNJV-SYIFMXBLSA-N |
| XLogP | 4.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |