C27H38N2O4 — CID 176578218
N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(2-cyclopropyloxyacetyl)piperidin-3-yl]benzamide (PubChem CID 176578218) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(2-cyclopropyloxyacetyl)piperidin-3-yl]benzamide.
| Compound Name | N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(2-cyclopropyloxyacetyl)piperidin-3-yl]benzamide |
|---|---|
| PubChem CID | 176578218 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | N-[(1R)-1-cyclohexyl-2-oxobutyl]-3-[1-(2-cyclopropyloxyacetyl)piperidin-3-yl]benzamide |
| SMILES | CCC(=O)[C@H](NC(=O)c1cccc(C2CCCN(C(=O)COC3CC3)C2)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H38N2O4/c1-2-24(30)26(19-8-4-3-5-9-19)28-27(32)21-11-6-10-20(16-21)22-12-7-15-29(17-22)25(31)18-33-23-13-14-23/h6,10-11,16,19,22-23,26H,2-5,7-9,12-15,17-18H2,1H3,(H,28,32)/t22?,26-/m1/s1 |
| InChIKey | DMVFTIAFSZDXNL-ZWAGFTRDSA-N |
| XLogP | 4.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |