C28H37F2N3O3 — CID 176580272
N-[(1R)-1-cyclohexyl-3-methyl-2-oxobut-3-enyl]-5-[1-[2-(cyclopropylamino)acetyl]piperidin-3-yl]-2,4-difluorobenzamide (PubChem CID 176580272) has the molecular formula C28H37F2N3O3 and a molecular weight of 501.62 g/mol. Its IUPAC name is N-[(1R)-1-cyclohexyl-3-methyl-2-oxobut-3-enyl]-5-[1-[2-(cyclopropylamino)acetyl]piperidin-3-yl]-2,4-difluorobenzamide.
| Compound Name | N-[(1R)-1-cyclohexyl-3-methyl-2-oxobut-3-enyl]-5-[1-[2-(cyclopropylamino)acetyl]piperidin-3-yl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 176580272 |
| Molecular Formula | C28H37F2N3O3 |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.28 |
| IUPAC Name | N-[(1R)-1-cyclohexyl-3-methyl-2-oxobut-3-enyl]-5-[1-[2-(cyclopropylamino)acetyl]piperidin-3-yl]-2,4-difluorobenzamide |
| SMILES | C=C(C)C(=O)[C@H](NC(=O)c1cc(C2CCCN(C(=O)CNC3CC3)C2)c(F)cc1F)C1CCCCC1 |
| InChI | InChI=1S/C28H37F2N3O3/c1-17(2)27(35)26(18-7-4-3-5-8-18)32-28(36)22-13-21(23(29)14-24(22)30)19-9-6-12-33(16-19)25(34)15-31-20-10-11-20/h13-14,18-20,26,31H,1,3-12,15-16H2,2H3,(H,32,36)/t19?,26-/m1/s1 |
| InChIKey | WCZXPBIEPIJPPT-COTLDPOVSA-N |
| XLogP | 4.25 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|