C18H35N3O3 — CID 176580768
tert-butyl N-[1-cyclohexyl-2-[ethyl-[2-(methylamino)ethyl]amino]-2-oxoethyl]carbamate (PubChem CID 176580768) has the molecular formula C18H35N3O3 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl N-[1-cyclohexyl-2-[ethyl-[2-(methylamino)ethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclohexyl-2-[ethyl-[2-(methylamino)ethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 176580768 |
| Molecular Formula | C18H35N3O3 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.27 |
| IUPAC Name | tert-butyl N-[1-cyclohexyl-2-[ethyl-[2-(methylamino)ethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CCN(CCNC)C(=O)C(NC(=O)OC(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C18H35N3O3/c1-6-21(13-12-19-5)16(22)15(14-10-8-7-9-11-14)20-17(23)24-18(2,3)4/h14-15,19H,6-13H2,1-5H3,(H,20,23) |
| InChIKey | ZDYLNTOAHMPTHG-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |