C34H44FN7O4 — CID 176581677
N-[(Z)-[2-[4-fluoro-3-[4-[2-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]acetyl]piperazine-1-carbonyl]phenyl]-1-(2-methylphenyl)ethylidene]amino]formamide (PubChem CID 176581677) has the molecular formula C34H44FN7O4 and a molecular weight of 633.77 g/mol. Its IUPAC name is N-[(Z)-[2-[4-fluoro-3-[4-[2-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]acetyl]piperazine-1-carbonyl]phenyl]-1-(2-methylphenyl)ethylidene]amino]formamide.
| Compound Name | N-[(Z)-[2-[4-fluoro-3-[4-[2-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]acetyl]piperazine-1-carbonyl]phenyl]-1-(2-methylphenyl)ethylidene]amino]formamide |
|---|---|
| PubChem CID | 176581677 |
| Molecular Formula | C34H44FN7O4 |
| Molecular Weight | 633.77 g/mol |
| Exact Mass | 633.34 |
| IUPAC Name | N-[(Z)-[2-[4-fluoro-3-[4-[2-[4-[(1-formylpiperidin-4-yl)methyl]piperazin-1-yl]acetyl]piperazine-1-carbonyl]phenyl]-1-(2-methylphenyl)ethylidene]amino]formamide |
| SMILES | Cc1ccccc1/C(Cc1ccc(F)c(C(=O)N2CCN(C(=O)CN3CCN(CC4CCN(C=O)CC4)CC3)CC2)c1)=N\NC=O |
| InChI | InChI=1S/C34H44FN7O4/c1-26-4-2-3-5-29(26)32(37-36-24-43)21-28-6-7-31(35)30(20-28)34(46)42-18-16-41(17-19-42)33(45)23-39-14-12-38(13-15-39)22-27-8-10-40(25-44)11-9-27/h2-7,20,24-25,27H,8-19,21-23H2,1H3,(H,36,43)/b37-32- |
| InChIKey | NEFAQKDZZTZULY-FTTXPQLCSA-N |
| XLogP | 1.60 |
| TPSA | 108.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.77 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|