C25H30ClFN4O3 — CID 176581448
N-[(Z)-[2-[3-[4-(2-chloroacetyl)piperazine-1-carbonyl]-4-fluorophenyl]-1-(2-methylphenyl)ethylidene]amino]formamide;ethane (PubChem CID 176581448) has the molecular formula C25H30ClFN4O3 and a molecular weight of 488.99 g/mol. Its IUPAC name is N-[(Z)-[2-[3-[4-(2-chloroacetyl)piperazine-1-carbonyl]-4-fluorophenyl]-1-(2-methylphenyl)ethylidene]amino]formamide;ethane.
| Compound Name | N-[(Z)-[2-[3-[4-(2-chloroacetyl)piperazine-1-carbonyl]-4-fluorophenyl]-1-(2-methylphenyl)ethylidene]amino]formamide;ethane |
|---|---|
| PubChem CID | 176581448 |
| Molecular Formula | C25H30ClFN4O3 |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | N-[(Z)-[2-[3-[4-(2-chloroacetyl)piperazine-1-carbonyl]-4-fluorophenyl]-1-(2-methylphenyl)ethylidene]amino]formamide;ethane |
| SMILES | CC.Cc1ccccc1/C(Cc1ccc(F)c(C(=O)N2CCN(C(=O)CCl)CC2)c1)=N\NC=O |
| InChI | InChI=1S/C23H24ClFN4O3.C2H6/c1-16-4-2-3-5-18(16)21(27-26-15-30)13-17-6-7-20(25)19(12-17)23(32)29-10-8-28(9-11-29)22(31)14-24;1-2/h2-7,12,15H,8-11,13-14H2,1H3,(H,26,30);1-2H3/b27-21-; |
| InChIKey | IIIPSVRRLZHVLY-DJILMAANSA-N |
| XLogP | 3.38 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|