C27H34FN5O4 — CID 176579700
N-[2-(2-aminoethoxy)ethyl]-N-[2-[4-[2-fluoro-5-[2-imino-2-(2-methylphenyl)ethyl]benzoyl]piperazin-1-yl]-2-oxoethyl]formamide (PubChem CID 176579700) has the molecular formula C27H34FN5O4 and a molecular weight of 511.60 g/mol. Its IUPAC name is N-[2-(2-aminoethoxy)ethyl]-N-[2-[4-[2-fluoro-5-[2-imino-2-(2-methylphenyl)ethyl]benzoyl]piperazin-1-yl]-2-oxoethyl]formamide.
| Compound Name | N-[2-(2-aminoethoxy)ethyl]-N-[2-[4-[2-fluoro-5-[2-imino-2-(2-methylphenyl)ethyl]benzoyl]piperazin-1-yl]-2-oxoethyl]formamide |
|---|---|
| PubChem CID | 176579700 |
| Molecular Formula | C27H34FN5O4 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | N-[2-(2-aminoethoxy)ethyl]-N-[2-[4-[2-fluoro-5-[2-imino-2-(2-methylphenyl)ethyl]benzoyl]piperazin-1-yl]-2-oxoethyl]formamide |
| SMILES | [H]/N=C(/Cc1ccc(F)c(C(=O)N2CCN(C(=O)CN(C=O)CCOCCN)CC2)c1)c1ccccc1C |
| InChI | InChI=1S/C27H34FN5O4/c1-20-4-2-3-5-22(20)25(30)17-21-6-7-24(28)23(16-21)27(36)33-11-9-32(10-12-33)26(35)18-31(19-34)13-15-37-14-8-29/h2-7,16,19,30H,8-15,17-18,29H2,1H3/b30-25- |
| InChIKey | CYZIOXMFEXZSEI-JVCXMKTPSA-N |
| XLogP | 1.46 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|