C26H33FN6O4 — CID 176579181
2-[2-[3-[4-[2-[2-(2-aminoethoxy)ethylamino]acetyl]piperazine-1-carbonyl]-4-fluorophenyl]ethanimidoyl]benzamide (PubChem CID 176579181) has the molecular formula C26H33FN6O4 and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-[2-[3-[4-[2-[2-(2-aminoethoxy)ethylamino]acetyl]piperazine-1-carbonyl]-4-fluorophenyl]ethanimidoyl]benzamide.
| Compound Name | 2-[2-[3-[4-[2-[2-(2-aminoethoxy)ethylamino]acetyl]piperazine-1-carbonyl]-4-fluorophenyl]ethanimidoyl]benzamide |
|---|---|
| PubChem CID | 176579181 |
| Molecular Formula | C26H33FN6O4 |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 2-[2-[3-[4-[2-[2-(2-aminoethoxy)ethylamino]acetyl]piperazine-1-carbonyl]-4-fluorophenyl]ethanimidoyl]benzamide |
| SMILES | [H]/N=C(\Cc1ccc(F)c(C(=O)N2CCN(C(=O)CNCCOCCN)CC2)c1)c1ccccc1C(N)=O |
| InChI | InChI=1S/C26H33FN6O4/c27-22-6-5-18(16-23(29)19-3-1-2-4-20(19)25(30)35)15-21(22)26(36)33-11-9-32(10-12-33)24(34)17-31-8-14-37-13-7-28/h1-6,15,29,31H,7-14,16-17,28H2,(H2,30,35)/b29-23+ |
| InChIKey | ZSVNHHUNJHQOLK-BYNJWEBRSA-N |
| XLogP | 0.38 |
| TPSA | 154.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|