C33H46FN7O3 — CID 176578259
2-[2-(4-fluoro-3-formylphenyl)ethanimidoyl]benzamide;1-(4-methylpiperazin-1-yl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 176578259) has the molecular formula C33H46FN7O3 and a molecular weight of 607.78 g/mol. Its IUPAC name is 2-[2-(4-fluoro-3-formylphenyl)ethanimidoyl]benzamide;1-(4-methylpiperazin-1-yl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[2-(4-fluoro-3-formylphenyl)ethanimidoyl]benzamide;1-(4-methylpiperazin-1-yl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 176578259 |
| Molecular Formula | C33H46FN7O3 |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.36 |
| IUPAC Name | 2-[2-(4-fluoro-3-formylphenyl)ethanimidoyl]benzamide;1-(4-methylpiperazin-1-yl)-2-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CN1CCN(C(=O)CN2CCN(CC3CCNCC3)CC2)CC1.[H]/N=C(\Cc1ccc(F)c(C=O)c1)c1ccccc1C(N)=O |
| InChI | InChI=1S/C17H33N5O.C16H13FN2O2/c1-19-6-12-22(13-7-19)17(23)15-21-10-8-20(9-11-21)14-16-2-4-18-5-3-16;17-14-6-5-10(7-11(14)9-20)8-15(18)12-3-1-2-4-13(12)16(19)21/h16,18H,2-15H2,1H3;1-7,9,18H,8H2,(H2,19,21)/b;18-15+ |
| InChIKey | BAKMOBRAYXCKSQ-MWBMOHLZSA-N |
| XLogP | 1.73 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|