About (2E,6E)-9-tert-butyltrideca-2,6-diene
(2E,6E)-9-tert-butyltrideca-2,6-diene (PubChem CID 176585534) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is (2E,6E)-9-tert-butyltrideca-2,6-diene.
Molecular Properties
| Compound Name | (2E,6E)-9-tert-butyltrideca-2,6-diene |
| PubChem CID | 176585534 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | (2E,6E)-9-tert-butyltrideca-2,6-diene |
| SMILES | C/C=C/CC/C=C/CC(CCCC)C(C)(C)C |
| InChI | InChI=1S/C17H32/c1-6-8-10-11-12-13-15-16(14-9-7-2)17(3,4)5/h6,8,12-13,16H,7,9-11,14-15H2,1-5H3/b8-6+,13-12+ |
| InChIKey | MOUXLVZXVNZIDB-JQAHBYNNSA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E,6E)-9-tert-butyltrideca-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6E)-9-tert-butyltrideca-2,6-diene?
The IUPAC name of (2E,6E)-9-tert-butyltrideca-2,6-diene (CID 176585534) is (2E,6E)-9-tert-butyltrideca-2,6-diene.
What is the SMILES notation for (2E,6E)-9-tert-butyltrideca-2,6-diene?
The canonical SMILES for (2E,6E)-9-tert-butyltrideca-2,6-diene is C/C=C/CC/C=C/CC(CCCC)C(C)(C)C.
What is the InChIKey of (2E,6E)-9-tert-butyltrideca-2,6-diene?
The InChIKey is MOUXLVZXVNZIDB-JQAHBYNNSA-N. The full InChI is InChI=1S/C17H32/c1-6-8-10-11-12-13-15-16(14-9-7-2)17(3,4)5/h6,8,12-13,16H,7,9-11,14-15H2,1-5H3/b8-6+,13-12+.
What are the key properties of (2E,6E)-9-tert-butyltrideca-2,6-diene?
(2E,6E)-9-tert-butyltrideca-2,6-diene has a molecular weight of 236.44 g/mol, XLogP of 6.14, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-9-tert-butyltrideca-2,6-diene is sourced from PubChem (CID 176585534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).