C13H16BBrN2O2 — CID 176586103
3-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine (PubChem CID 176586103) has the molecular formula C13H16BBrN2O2 and a molecular weight of 323.00 g/mol. Its IUPAC name is 3-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine.
| Compound Name | 3-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 176586103 |
| Molecular Formula | C13H16BBrN2O2 |
| Molecular Weight | 323.00 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-bromo-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine |
| SMILES | CC1(C)OB(c2nc3ccccn3c2Br)OC1(C)C |
| InChI | InChI=1S/C13H16BBrN2O2/c1-12(2)13(3,4)19-14(18-12)10-11(15)17-8-6-5-7-9(17)16-10/h5-8H,1-4H3 |
| InChIKey | YFIVSPPJLLUGHS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.00 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|