C21H22O7 — CID 176589640
ethyl [4-[(2R,3R)-5-formyl-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl] carbonate (PubChem CID 176589640) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl [4-[(2R,3R)-5-formyl-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl] carbonate.
| Compound Name | ethyl [4-[(2R,3R)-5-formyl-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl] carbonate |
|---|---|
| PubChem CID | 176589640 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl [4-[(2R,3R)-5-formyl-7-methoxy-3-methyl-2,3-dihydro-1-benzofuran-2-yl]-2-methoxyphenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc([C@@H]2Oc3c(OC)cc(C=O)cc3[C@H]2C)cc1OC |
| InChI | InChI=1S/C21H22O7/c1-5-26-21(23)27-16-7-6-14(10-17(16)24-3)19-12(2)15-8-13(11-22)9-18(25-4)20(15)28-19/h6-12,19H,5H2,1-4H3/t12-,19-/m1/s1 |
| InChIKey | SFYGUGPWFBRDKV-CWTRNNRKSA-N |
| XLogP | 4.29 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|