C40H29N — CID 176590504
N-[4-(1,4,5,6,7,8-hexadeuterio-3-phenylnaphthalen-2-yl)phenyl]-N,4-diphenylaniline (PubChem CID 176590504) has the molecular formula C40H29N and a molecular weight of 529.72 g/mol. Its IUPAC name is N-[4-(1,4,5,6,7,8-hexadeuterio-3-phenylnaphthalen-2-yl)phenyl]-N,4-diphenylaniline.
| Compound Name | N-[4-(1,4,5,6,7,8-hexadeuterio-3-phenylnaphthalen-2-yl)phenyl]-N,4-diphenylaniline |
|---|---|
| PubChem CID | 176590504 |
| Molecular Formula | C40H29N |
| Molecular Weight | 529.72 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | N-[4-(1,4,5,6,7,8-hexadeuterio-3-phenylnaphthalen-2-yl)phenyl]-N,4-diphenylaniline |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(-c3ccc(N(c4ccccc4)c4ccc(-c5ccccc5)cc4)cc3)c(-c3ccccc3)c([2H])c2c1[2H] |
| InChI | InChI=1S/C40H29N/c1-4-12-30(13-5-1)31-20-24-37(25-21-31)41(36-18-8-3-9-19-36)38-26-22-33(23-27-38)40-29-35-17-11-10-16-34(35)28-39(40)32-14-6-2-7-15-32/h1-29H/i10D,11D,16D,17D,28D,29D |
| InChIKey | YKBWTEAZBOYSJA-VEZZGTEUSA-N |
| XLogP | 11.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.72 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |