C17H17ClN6O2 — CID 176590772
6-[6-chloro-4-[(2R,6S)-6-(isocyanomethyl)morpholin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide (PubChem CID 176590772) has the molecular formula C17H17ClN6O2 and a molecular weight of 372.82 g/mol. Its IUPAC name is 6-[6-chloro-4-[(2R,6S)-6-(isocyanomethyl)morpholin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[6-chloro-4-[(2R,6S)-6-(isocyanomethyl)morpholin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 176590772 |
| Molecular Formula | C17H17ClN6O2 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 6-[6-chloro-4-[(2R,6S)-6-(isocyanomethyl)morpholin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide |
| SMILES | [C-]#[N+]C[C@@H]1CNC[C@@H](c2cc(Cl)nc(-c3cc(C(=O)NC)ncn3)c2)O1 |
| InChI | InChI=1S/C17H17ClN6O2/c1-19-6-11-7-21-8-15(26-11)10-3-13(24-16(18)4-10)12-5-14(17(25)20-2)23-9-22-12/h3-5,9,11,15,21H,6-8H2,2H3,(H,20,25)/t11-,15+/m1/s1 |
| InChIKey | CTEDJAJAIUFQOI-ABAIWWIYSA-N |
| XLogP | 1.50 |
| TPSA | 93.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|