C16H19ClN6O2S — CID 176590819
6-[6-chloro-4-[(2R)-1-methylsulfinylpiperazin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide (PubChem CID 176590819) has the molecular formula C16H19ClN6O2S and a molecular weight of 394.89 g/mol. Its IUPAC name is 6-[6-chloro-4-[(2R)-1-methylsulfinylpiperazin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide.
| Compound Name | 6-[6-chloro-4-[(2R)-1-methylsulfinylpiperazin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 176590819 |
| Molecular Formula | C16H19ClN6O2S |
| Molecular Weight | 394.89 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 6-[6-chloro-4-[(2R)-1-methylsulfinylpiperazin-2-yl]-2-pyridinyl]-N-methylpyrimidine-4-carboxamide |
| SMILES | CNC(=O)c1cc(-c2cc([C@@H]3CNCCN3S(C)=O)cc(Cl)n2)ncn1 |
| InChI | InChI=1S/C16H19ClN6O2S/c1-18-16(24)13-7-11(20-9-21-13)12-5-10(6-15(17)22-12)14-8-19-3-4-23(14)26(2)25/h5-7,9,14,19H,3-4,8H2,1-2H3,(H,18,24)/t14-,26?/m0/s1 |
| InChIKey | ZUELIBUDJGTSEM-BAHZEXJQSA-N |
| XLogP | 0.79 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.89 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|