C39H46N4O9SSi — CID 176591917
[(2S)-3-acetyloxy-2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-thiazole-4-carbonyl]amino]propanoyl] (2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropanoate (PubChem CID 176591917) has the molecular formula C39H46N4O9SSi and a molecular weight of 774.97 g/mol. Its IUPAC name is [(2S)-3-acetyloxy-2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-thiazole-4-carbonyl]amino]propanoyl] (2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropanoate.
| Compound Name | [(2S)-3-acetyloxy-2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-thiazole-4-carbonyl]amino]propanoyl] (2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropanoate |
|---|---|
| PubChem CID | 176591917 |
| Molecular Formula | C39H46N4O9SSi |
| Molecular Weight | 774.97 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | [(2S)-3-acetyloxy-2-[[2-[3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-1,3-thiazole-4-carbonyl]amino]propanoyl] (2S)-2-amino-3-[tert-butyl(diphenyl)silyl]oxypropanoate |
| SMILES | CC(=O)OC[C@H](NC(=O)c1csc(-c2cccc(NC(=O)OC(C)(C)C)c2)n1)C(=O)OC(=O)[C@@H](N)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C39H46N4O9SSi/c1-25(44)49-23-31(42-33(45)32-24-53-34(43-32)26-15-14-16-27(21-26)41-37(48)52-38(2,3)4)36(47)51-35(46)30(40)22-50-54(39(5,6)7,28-17-10-8-11-18-28)29-19-12-9-13-20-29/h8-21,24,30-31H,22-23,40H2,1-7H3,(H,41,48)(H,42,45)/t30-,31-/m0/s1 |
| InChIKey | CCSGEJLWNHXDLS-CONSDPRKSA-N |
| XLogP | 4.79 |
| TPSA | 185.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.97 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|