C53H41NO3 — CID 176592194
2-[(2Z)-2-[6-tert-butyl-3-[4-methyl-2,6-bis(4-phenylphenyl)phenyl]-1,3-benzoxazol-2-ylidene]ethylidene]indene-1,3-dione (PubChem CID 176592194) has the molecular formula C53H41NO3 and a molecular weight of 739.92 g/mol. Its IUPAC name is 2-[(2Z)-2-[6-tert-butyl-3-[4-methyl-2,6-bis(4-phenylphenyl)phenyl]-1,3-benzoxazol-2-ylidene]ethylidene]indene-1,3-dione.
| Compound Name | 2-[(2Z)-2-[6-tert-butyl-3-[4-methyl-2,6-bis(4-phenylphenyl)phenyl]-1,3-benzoxazol-2-ylidene]ethylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 176592194 |
| Molecular Formula | C53H41NO3 |
| Molecular Weight | 739.92 g/mol |
| Exact Mass | 739.31 |
| IUPAC Name | 2-[(2Z)-2-[6-tert-butyl-3-[4-methyl-2,6-bis(4-phenylphenyl)phenyl]-1,3-benzoxazol-2-ylidene]ethylidene]indene-1,3-dione |
| SMILES | Cc1cc(-c2ccc(-c3ccccc3)cc2)c(N2/C(=C/C=C3C(=O)c4ccccc4C3=O)Oc3cc(C(C)(C)C)ccc32)c(-c2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C53H41NO3/c1-34-31-45(39-23-19-37(20-24-39)35-13-7-5-8-14-35)50(46(32-34)40-25-21-38(22-26-40)36-15-9-6-10-16-36)54-47-29-27-41(53(2,3)4)33-48(47)57-49(54)30-28-44-51(55)42-17-11-12-18-43(42)52(44)56/h5-33H,1-4H3/b49-30- |
| InChIKey | VVQGSZLXUYYAKT-MVBFOZEESA-N |
| XLogP | 13.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.92 |
| LogP ≤ 5 | 13.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|