C29H38N4O7 — CID 176593825
CID 176593825 (PubChem CID 176593825) has the molecular formula C29H38N4O7 and a molecular weight of 554.64 g/mol.
| Compound Name | CID 176593825 |
|---|---|
| PubChem CID | 176593825 |
| Molecular Formula | C29H38N4O7 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)N1Cc2c(nc(-c3onc4c3CCC[C@@]43CCCCC34OCCO4)[nH]c2=O)[C@]2(CCOC2)C1 |
| InChI | InChI=1S/C29H38N4O7/c1-26(2,3)39-25(35)33-15-19-21(27(16-33)11-12-36-17-27)30-23(31-24(19)34)20-18-7-6-9-28(22(18)32-40-20)8-4-5-10-29(28)37-13-14-38-29/h4-17H2,1-3H3,(H,30,31,34)/t27-,28+/m1/s1 |
| InChIKey | NYGVZAKDUWNJNU-IZLXSDGUSA-N |
| XLogP | 3.72 |
| TPSA | 129.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |