C46H53NS — CID 176595054
N-(4-tert-butylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-2'-amine (PubChem CID 176595054) has the molecular formula C46H53NS and a molecular weight of 652.00 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-2'-amine.
| Compound Name | N-(4-tert-butylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-2'-amine |
|---|---|
| PubChem CID | 176595054 |
| Molecular Formula | C46H53NS |
| Molecular Weight | 652.00 g/mol |
| Exact Mass | 651.39 |
| IUPAC Name | N-(4-tert-butylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-2'-amine |
| SMILES | CC(C)(C)c1ccc(N(c2ccc3c(c2)C(C)(C)CCC3(C)C)c2ccc3c(c2)C2(c4ccccc4S3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C46H53NS/c1-43(2,3)31-12-14-34(15-13-31)47(35-16-18-37-39(27-35)45(6,7)21-20-44(37,4)5)36-17-19-42-40(28-36)46(38-10-8-9-11-41(38)48-42)32-23-29-22-30(25-32)26-33(46)24-29/h8-19,27-30,32-33H,20-26H2,1-7H3 |
| InChIKey | LTAVWIDDWLCNKA-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.00 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |