C58H61N — CID 176595459
7'-(4-tert-butylphenyl)-N-(4-phenylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-2'-amine (PubChem CID 176595459) has the molecular formula C58H61N and a molecular weight of 772.13 g/mol. Its IUPAC name is 7'-(4-tert-butylphenyl)-N-(4-phenylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-2'-amine.
| Compound Name | 7'-(4-tert-butylphenyl)-N-(4-phenylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-2'-amine |
|---|---|
| PubChem CID | 176595459 |
| Molecular Formula | C58H61N |
| Molecular Weight | 772.13 g/mol |
| Exact Mass | 771.48 |
| IUPAC Name | 7'-(4-tert-butylphenyl)-N-(4-phenylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-2'-amine |
| SMILES | CC(C)(C)c1ccc(-c2ccc3c(c2)C2(c4cc(N(c5ccc(-c6ccccc6)cc5)c5ccc6c(c5)C(C)(C)CCC6(C)C)ccc4-3)C3CC4CC(C3)CC2C4)cc1 |
| InChI | InChI=1S/C58H61N/c1-55(2,3)43-18-13-41(14-19-43)42-17-24-49-50-25-22-47(35-53(50)58(52(49)34-42)44-30-37-29-38(32-44)33-45(58)31-37)59(46-20-15-40(16-21-46)39-11-9-8-10-12-39)48-23-26-51-54(36-48)57(6,7)28-27-56(51,4)5/h8-26,34-38,44-45H,27-33H2,1-7H3 |
| InChIKey | UISIDEIWYOLACW-UHFFFAOYSA-N |
| XLogP | 15.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.13 |
| LogP ≤ 5 | 15.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |