C57H57N — CID 176594755
9,9-dimethyl-N-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine (PubChem CID 176594755) has the molecular formula C57H57N and a molecular weight of 756.09 g/mol. Its IUPAC name is 9,9-dimethyl-N-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine.
| Compound Name | 9,9-dimethyl-N-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
|---|---|
| PubChem CID | 176594755 |
| Molecular Formula | C57H57N |
| Molecular Weight | 756.09 g/mol |
| Exact Mass | 755.45 |
| IUPAC Name | 9,9-dimethyl-N-(4-spiro[adamantane-2,9'-fluorene]-2'-ylphenyl)-N-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)fluoren-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(c3ccc(-c4ccc5c(c4)C4(c6ccccc6-5)C5CC6CC(C5)CC4C6)cc3)c3ccc4c(c3)C(C)(C)c3ccccc3-4)ccc21 |
| InChI | InChI=1S/C57H57N/c1-54(2)25-26-55(3,4)53-34-43(21-24-50(53)54)58(42-20-23-46-44-11-7-9-13-48(44)56(5,6)51(46)33-42)41-18-15-37(16-19-41)38-17-22-47-45-12-8-10-14-49(45)57(52(47)32-38)39-28-35-27-36(30-39)31-40(57)29-35/h7-24,32-36,39-40H,25-31H2,1-6H3 |
| InChIKey | OAIIEUIFFYUYNG-UHFFFAOYSA-N |
| XLogP | 15.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.09 |
| LogP ≤ 5 | 15.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |