C56H63N — CID 176595869
6'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-3'-amine (PubChem CID 176595869) has the molecular formula C56H63N and a molecular weight of 750.13 g/mol. Its IUPAC name is 6'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-3'-amine.
| Compound Name | 6'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-3'-amine |
|---|---|
| PubChem CID | 176595869 |
| Molecular Formula | C56H63N |
| Molecular Weight | 750.13 g/mol |
| Exact Mass | 749.50 |
| IUPAC Name | 6'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-fluorene]-3'-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(c3ccc4c(c3)-c3cc(-c5ccccc5)ccc3C43C4CC5CC(C4)CC3C5)c3ccc4c(c3)C(C)(C)CCC4(C)C)ccc21 |
| InChI | InChI=1S/C56H63N/c1-52(2)22-24-54(5,6)50-33-42(16-20-48(50)52)57(43-17-21-49-51(34-43)55(7,8)25-23-53(49,3)4)41-15-19-47-45(32-41)44-31-38(37-12-10-9-11-13-37)14-18-46(44)56(47)39-27-35-26-36(29-39)30-40(56)28-35/h9-21,31-36,39-40H,22-30H2,1-8H3 |
| InChIKey | MBVNLXFNPRTQNT-UHFFFAOYSA-N |
| XLogP | 15.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.13 |
| LogP ≤ 5 | 15.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |