C56H63NS — CID 176595118
5'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-3'-amine (PubChem CID 176595118) has the molecular formula C56H63NS and a molecular weight of 782.19 g/mol. Its IUPAC name is 5'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-3'-amine.
| Compound Name | 5'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-3'-amine |
|---|---|
| PubChem CID | 176595118 |
| Molecular Formula | C56H63NS |
| Molecular Weight | 782.19 g/mol |
| Exact Mass | 781.47 |
| IUPAC Name | 5'-phenyl-N,N-bis(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)spiro[adamantane-2,9'-thioxanthene]-3'-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(N(c3ccc4c(c3)Sc3c(-c5ccccc5)cccc3C43C4CC5CC(C4)CC3C5)c3ccc4c(c3)C(C)(C)CCC4(C)C)ccc21 |
| InChI | InChI=1S/C56H63NS/c1-52(2)23-25-54(5,6)48-32-40(17-20-44(48)52)57(41-18-21-45-49(33-41)55(7,8)26-24-53(45,3)4)42-19-22-46-50(34-42)58-51-43(37-13-10-9-11-14-37)15-12-16-47(51)56(46)38-28-35-27-36(30-38)31-39(56)29-35/h9-22,32-36,38-39H,23-31H2,1-8H3 |
| InChIKey | GMDPOIWLTUOFAB-UHFFFAOYSA-N |
| XLogP | 15.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.19 |
| LogP ≤ 5 | 15.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |