C10H22N2O — CID 176597370
1-methyl-4-(2-propan-2-yloxyethyl)-1,3-diazinane (PubChem CID 176597370) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-methyl-4-(2-propan-2-yloxyethyl)-1,3-diazinane.
| Compound Name | 1-methyl-4-(2-propan-2-yloxyethyl)-1,3-diazinane |
|---|---|
| PubChem CID | 176597370 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1-methyl-4-(2-propan-2-yloxyethyl)-1,3-diazinane |
| SMILES | CC(C)OCCC1CCN(C)CN1 |
| InChI | InChI=1S/C10H22N2O/c1-9(2)13-7-5-10-4-6-12(3)8-11-10/h9-11H,4-8H2,1-3H3 |
| InChIKey | KCZPQKWKDISSNM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |