C12H26N2O — CID 64871501
3-ethyl-1-(2-propan-2-yloxyethyl)-1,4-diazepane (PubChem CID 64871501) has the molecular formula C12H26N2O and a molecular weight of 214.35 g/mol. Its IUPAC name is 3-ethyl-1-(2-propan-2-yloxyethyl)-1,4-diazepane.
| Compound Name | 3-ethyl-1-(2-propan-2-yloxyethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64871501 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 3-ethyl-1-(2-propan-2-yloxyethyl)-1,4-diazepane |
| SMILES | CCC1CN(CCOC(C)C)CCCN1 |
| InChI | InChI=1S/C12H26N2O/c1-4-12-10-14(7-5-6-13-12)8-9-15-11(2)3/h11-13H,4-10H2,1-3H3 |
| InChIKey | UQKKBVMWFRUEGO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |