C22H15F2N5O2S — CID 176600294
N-[5-(2-cyclopropylethynyl)-1,3,4-thiadiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-isocyanobenzamide (PubChem CID 176600294) has the molecular formula C22H15F2N5O2S and a molecular weight of 451.46 g/mol. Its IUPAC name is N-[5-(2-cyclopropylethynyl)-1,3,4-thiadiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-isocyanobenzamide.
| Compound Name | N-[5-(2-cyclopropylethynyl)-1,3,4-thiadiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-isocyanobenzamide |
|---|---|
| PubChem CID | 176600294 |
| Molecular Formula | C22H15F2N5O2S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N-[5-(2-cyclopropylethynyl)-1,3,4-thiadiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-isocyanobenzamide |
| SMILES | [C-]#[N+]c1ccc(C(=O)Nc2nnc(C#CC3CC3)s2)c(-c2cc(C(F)F)ncc2OC)c1 |
| InChI | InChI=1S/C22H15F2N5O2S/c1-25-13-6-7-14(15(9-13)16-10-17(20(23)24)26-11-18(16)31-2)21(30)27-22-29-28-19(32-22)8-5-12-3-4-12/h6-7,9-12,20H,3-4H2,2H3,(H,27,29,30) |
| InChIKey | CLBPRXMMXYMQDG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 81.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|