C24H18F2N4O2S — CID 176600393
N-[5-(2-cyclopropylethynyl)-1,3-thiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzamide (PubChem CID 176600393) has the molecular formula C24H18F2N4O2S and a molecular weight of 464.50 g/mol. Its IUPAC name is N-[5-(2-cyclopropylethynyl)-1,3-thiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzamide.
| Compound Name | N-[5-(2-cyclopropylethynyl)-1,3-thiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzamide |
|---|---|
| PubChem CID | 176600393 |
| Molecular Formula | C24H18F2N4O2S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | N-[5-(2-cyclopropylethynyl)-1,3-thiazol-2-yl]-2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzamide |
| SMILES | [C-]#[N+]Cc1ccc(C(=O)Nc2ncc(C#CC3CC3)s2)c(-c2cc(C(F)F)ncc2OC)c1 |
| InChI | InChI=1S/C24H18F2N4O2S/c1-27-11-15-6-8-17(18(9-15)19-10-20(22(25)26)28-13-21(19)32-2)23(31)30-24-29-12-16(33-24)7-5-14-3-4-14/h6,8-10,12-14,22H,3-4,11H2,2H3,(H,29,30,31) |
| InChIKey | GMYBYHULIKTXOX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|