C17H14F2N2O3 — CID 176600419
methyl 2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzoate (PubChem CID 176600419) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is methyl 2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzoate.
| Compound Name | methyl 2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzoate |
|---|---|
| PubChem CID | 176600419 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl 2-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-4-(isocyanomethyl)benzoate |
| SMILES | [C-]#[N+]Cc1ccc(C(=O)OC)c(-c2cc(C(F)F)ncc2OC)c1 |
| InChI | InChI=1S/C17H14F2N2O3/c1-20-8-10-4-5-11(17(22)24-3)12(6-10)13-7-14(16(18)19)21-9-15(13)23-2/h4-7,9,16H,8H2,2-3H3 |
| InChIKey | AOIHAHHKSMZNSG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|