C15H11F2N3O3 — CID 176600314
4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(isocyanomethyl)pyridine-3-carboxylic acid (PubChem CID 176600314) has the molecular formula C15H11F2N3O3 and a molecular weight of 319.27 g/mol. Its IUPAC name is 4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(isocyanomethyl)pyridine-3-carboxylic acid.
| Compound Name | 4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(isocyanomethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 176600314 |
| Molecular Formula | C15H11F2N3O3 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 4-[2-(difluoromethyl)-5-methoxy-4-pyridinyl]-6-(isocyanomethyl)pyridine-3-carboxylic acid |
| SMILES | [C-]#[N+]Cc1cc(-c2cc(C(F)F)ncc2OC)c(C(=O)O)cn1 |
| InChI | InChI=1S/C15H11F2N3O3/c1-18-5-8-3-9(11(6-19-8)15(21)22)10-4-12(14(16)17)20-7-13(10)23-2/h3-4,6-7,14H,5H2,2H3,(H,21,22) |
| InChIKey | VOJBZCPQWHPZDO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 76.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|