C36H73N5O3 — CID 176600762
3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl-[3-oxo-3-(undecan-5-ylamino)propyl]amino]-N-undecan-5-ylpropanamide (PubChem CID 176600762) has the molecular formula C36H73N5O3 and a molecular weight of 624.01 g/mol. Its IUPAC name is 3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl-[3-oxo-3-(undecan-5-ylamino)propyl]amino]-N-undecan-5-ylpropanamide.
| Compound Name | 3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl-[3-oxo-3-(undecan-5-ylamino)propyl]amino]-N-undecan-5-ylpropanamide |
|---|---|
| PubChem CID | 176600762 |
| Molecular Formula | C36H73N5O3 |
| Molecular Weight | 624.01 g/mol |
| Exact Mass | 623.57 |
| IUPAC Name | 3-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethyl-[3-oxo-3-(undecan-5-ylamino)propyl]amino]-N-undecan-5-ylpropanamide |
| SMILES | CCCCCCC(CCCC)NC(=O)CCN(CCC(=O)NC(CCCC)CCCCCC)CCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C36H73N5O3/c1-5-9-13-15-19-33(17-11-7-3)37-35(43)21-23-39(25-26-40-27-29-41(30-28-40)31-32-42)24-22-36(44)38-34(18-12-8-4)20-16-14-10-6-2/h33-34,42H,5-32H2,1-4H3,(H,37,43)(H,38,44) |
| InChIKey | WNGGSFMRFNUOEY-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.01 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|