C25H39NO3 — CID 176600909
[(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-methylpropanoate (PubChem CID 176600909) has the molecular formula C25H39NO3 and a molecular weight of 401.59 g/mol. Its IUPAC name is [(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-methylpropanoate.
| Compound Name | [(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-methylpropanoate |
|---|---|
| PubChem CID | 176600909 |
| Molecular Formula | C25H39NO3 |
| Molecular Weight | 401.59 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | [(E)-1-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino] 2-methylpropanoate |
| SMILES | C/C(=N\OC(=O)C(C)C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H39NO3/c1-15(2)23(28)29-26-16(3)20-8-9-21-19-7-6-17-14-18(27)10-12-24(17,4)22(19)11-13-25(20,21)5/h6,15,18-22,27H,7-14H2,1-5H3/b26-16+/t18-,19-,20+,21-,22-,24-,25+/m0/s1 |
| InChIKey | HBJTYCBXKRYNJP-IAHYKCQLSA-N |
| XLogP | 5.50 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|