C27H37NO2 — CID 71556462
10,13-dimethyl-17-[(Z)-C-methyl-N-phenoxycarbonimidoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 71556462) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is 10,13-dimethyl-17-[(Z)-C-methyl-N-phenoxycarbonimidoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | 10,13-dimethyl-17-[(Z)-C-methyl-N-phenoxycarbonimidoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 71556462 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | 10,13-dimethyl-17-[(Z)-C-methyl-N-phenoxycarbonimidoyl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C/C(=N/Oc1ccccc1)C1CCC2C3CC=C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C27H37NO2/c1-18(28-30-21-7-5-4-6-8-21)23-11-12-24-22-10-9-19-17-20(29)13-15-26(19,2)25(22)14-16-27(23,24)3/h4-9,20,22-25,29H,10-17H2,1-3H3/b28-18- |
| InChIKey | YJPSRFOSCRRWTF-VEILYXNESA-N |
| XLogP | 6.38 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|