C43H42F4O5S7 — CID 176603167
2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dithiatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176603167) has the molecular formula C43H42F4O5S7 and a molecular weight of 939.26 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dithiatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dithiatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176603167 |
| Molecular Formula | C43H42F4O5S7 |
| Molecular Weight | 939.26 g/mol |
| Exact Mass | 938.10 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(11,12-dithiatetracyclo[6.2.1.13,6.02,7]dodecan-4-yl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2CC3SC2C2C4CCC(S4)C32)cc(C2CC3SC2C2C4CCC(S4)C32)cc1C1CC2SC1C1C3CCC(S3)C21 |
| InChI | InChI=1S/C43H42F4O5S7/c44-34-36(46)42(59(49,50)51)37(47)35(45)38(34)52-43(48)27-14(16-10-25-29-19-2-5-22(54-19)32(29)40(16)57-25)7-12(13-9-24-28-18-1-4-21(53-18)31(28)39(13)56-24)8-15(27)17-11-26-30-20-3-6-23(55-20)33(30)41(17)58-26/h7-8,13,16-26,28-33,39-41H,1-6,9-11H2,(H,49,50,51) |
| InChIKey | PUQXLAWUAOVJQG-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.26 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|