C31H30F4O5S4 — CID 176603802
2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176603802) has the molecular formula C31H30F4O5S4 and a molecular weight of 686.84 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176603802 |
| Molecular Formula | C31H30F4O5S4 |
| Molecular Weight | 686.84 g/mol |
| Exact Mass | 686.09 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(7-thiabicyclo[2.2.1]heptan-2-yl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2CC3CCC2S3)cc(C2CC3CCC2S3)cc1C1CC2CCC1S2 |
| InChI | InChI=1S/C31H30F4O5S4/c32-25-27(34)30(44(37,38)39)28(35)26(33)29(25)40-31(36)24-19(17-10-14-2-5-22(17)42-14)7-12(16-9-13-1-4-21(16)41-13)8-20(24)18-11-15-3-6-23(18)43-15/h7-8,13-18,21-23H,1-6,9-11H2,(H,37,38,39) |
| InChIKey | REUOBPNWGRZIJU-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.84 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|