C10H18OS2 — CID 176603632
2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane (PubChem CID 176603632) has the molecular formula C10H18OS2 and a molecular weight of 218.39 g/mol. Its IUPAC name is 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane.
| Compound Name | 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane |
|---|---|
| PubChem CID | 176603632 |
| Molecular Formula | C10H18OS2 |
| Molecular Weight | 218.39 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 2-methyl-2-[2-[(E)-prop-1-enoxy]ethyl]-1,4-dithiane |
| SMILES | C/C=C/OCCC1(C)CSCCS1 |
| InChI | InChI=1S/C10H18OS2/c1-3-5-11-6-4-10(2)9-12-7-8-13-10/h3,5H,4,6-9H2,1-2H3/b5-3+ |
| InChIKey | BPZTZYYIULOFBM-HWKANZROSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|