C13H22O3 — CID 176604064
2-[2-(cyclohexylidenemethoxy)ethyl]-1,4-dioxane (PubChem CID 176604064) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2-[2-(cyclohexylidenemethoxy)ethyl]-1,4-dioxane.
| Compound Name | 2-[2-(cyclohexylidenemethoxy)ethyl]-1,4-dioxane |
|---|---|
| PubChem CID | 176604064 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2-[2-(cyclohexylidenemethoxy)ethyl]-1,4-dioxane |
| SMILES | C(OCCC1COCCO1)=C1CCCCC1 |
| InChI | InChI=1S/C13H22O3/c1-2-4-12(5-3-1)10-14-7-6-13-11-15-8-9-16-13/h10,13H,1-9,11H2 |
| InChIKey | NPDOAEWNVCLYQH-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|