C14H24O3 — CID 176604087
2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dioxane (PubChem CID 176604087) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dioxane.
| Compound Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dioxane |
|---|---|
| PubChem CID | 176604087 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 2-(cyclohexylidenemethoxymethyl)-2-ethyl-1,4-dioxane |
| SMILES | CCC1(COC=C2CCCCC2)COCCO1 |
| InChI | InChI=1S/C14H24O3/c1-2-14(11-15-8-9-17-14)12-16-10-13-6-4-3-5-7-13/h10H,2-9,11-12H2,1H3 |
| InChIKey | KZVKTMIPSMUUPK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|