C12H22OS2 — CID 176604157
2-ethyl-2-[3-[(E)-prop-1-enoxy]propyl]-1,4-dithiane (PubChem CID 176604157) has the molecular formula C12H22OS2 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-ethyl-2-[3-[(E)-prop-1-enoxy]propyl]-1,4-dithiane.
| Compound Name | 2-ethyl-2-[3-[(E)-prop-1-enoxy]propyl]-1,4-dithiane |
|---|---|
| PubChem CID | 176604157 |
| Molecular Formula | C12H22OS2 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-ethyl-2-[3-[(E)-prop-1-enoxy]propyl]-1,4-dithiane |
| SMILES | C/C=C/OCCCC1(CC)CSCCS1 |
| InChI | InChI=1S/C12H22OS2/c1-3-7-13-8-5-6-12(4-2)11-14-9-10-15-12/h3,7H,4-6,8-11H2,1-2H3/b7-3+ |
| InChIKey | WPNUPLDPDBXQQP-XVNBXDOJSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|