C9H16O3 — CID 176604203
2-methyl-2-[[(E)-prop-1-enoxy]methyl]-1,4-dioxane (PubChem CID 176604203) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 2-methyl-2-[[(E)-prop-1-enoxy]methyl]-1,4-dioxane.
| Compound Name | 2-methyl-2-[[(E)-prop-1-enoxy]methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 176604203 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 2-methyl-2-[[(E)-prop-1-enoxy]methyl]-1,4-dioxane |
| SMILES | C/C=C/OCC1(C)COCCO1 |
| InChI | InChI=1S/C9H16O3/c1-3-4-10-7-9(2)8-11-5-6-12-9/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | DZFRFGGEPRWMFY-ONEGZZNKSA-N |
| XLogP | 1.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|