C10H18O3 — CID 176604278
2-methyl-2-(2-methylprop-1-enoxymethyl)-1,4-dioxane (PubChem CID 176604278) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 2-methyl-2-(2-methylprop-1-enoxymethyl)-1,4-dioxane.
| Compound Name | 2-methyl-2-(2-methylprop-1-enoxymethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 176604278 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 2-methyl-2-(2-methylprop-1-enoxymethyl)-1,4-dioxane |
| SMILES | CC(C)=COCC1(C)COCCO1 |
| InChI | InChI=1S/C10H18O3/c1-9(2)6-12-8-10(3)7-11-4-5-13-10/h6H,4-5,7-8H2,1-3H3 |
| InChIKey | KWXYHCHIZXAOSD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|