C18H26O2 — CID 176604369
9-(cyclopentylidenemethoxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodecane (PubChem CID 176604369) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 9-(cyclopentylidenemethoxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodecane.
| Compound Name | 9-(cyclopentylidenemethoxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodecane |
|---|---|
| PubChem CID | 176604369 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 9-(cyclopentylidenemethoxymethyl)-11-oxatetracyclo[6.2.1.13,6.02,7]dodecane |
| SMILES | C(OCC1CC2OC1C1C3CCC(C3)C21)=C1CCCC1 |
| InChI | InChI=1S/C18H26O2/c1-2-4-11(3-1)9-19-10-14-8-15-16-12-5-6-13(7-12)17(16)18(14)20-15/h9,12-18H,1-8,10H2 |
| InChIKey | QBUCVEITLCMTQE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|