C9H16OS2 — CID 176604388
2-(ethenoxymethyl)-2-ethyl-1,4-dithiane (PubChem CID 176604388) has the molecular formula C9H16OS2 and a molecular weight of 204.36 g/mol. Its IUPAC name is 2-(ethenoxymethyl)-2-ethyl-1,4-dithiane.
| Compound Name | 2-(ethenoxymethyl)-2-ethyl-1,4-dithiane |
|---|---|
| PubChem CID | 176604388 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 2-(ethenoxymethyl)-2-ethyl-1,4-dithiane |
| SMILES | C=COCC1(CC)CSCCS1 |
| InChI | InChI=1S/C9H16OS2/c1-3-9(7-10-4-2)8-11-5-6-12-9/h4H,2-3,5-8H2,1H3 |
| InChIKey | CRQQTAMHVWWDNF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|