C34H36F4O5S — CID 176604869
2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)benzoyl]oxybenzenesulfonic acid (PubChem CID 176604869) has the molecular formula C34H36F4O5S and a molecular weight of 632.72 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)benzoyl]oxybenzenesulfonic acid.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)benzoyl]oxybenzenesulfonic acid |
|---|---|
| PubChem CID | 176604869 |
| Molecular Formula | C34H36F4O5S |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,4,6-tris(2-bicyclo[2.2.1]heptanyl)benzoyl]oxybenzenesulfonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)O)c(F)c1F)c1c(C2CC3CCC2C3)cc(C2CC3CCC2C3)cc1C1CC2CCC1C2 |
| InChI | InChI=1S/C34H36F4O5S/c35-28-30(37)33(44(40,41)42)31(38)29(36)32(28)43-34(39)27-25(23-11-16-2-5-19(23)8-16)13-21(22-10-15-1-4-18(22)7-15)14-26(27)24-12-17-3-6-20(24)9-17/h13-20,22-24H,1-12H2,(H,40,41,42) |
| InChIKey | DOKJQXLHZBNSQT-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|