C33H29F4O7S- — CID 176603591
4-[2,5-bis(4-oxo-1-adamantyl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate (PubChem CID 176603591) has the molecular formula C33H29F4O7S- and a molecular weight of 645.65 g/mol. Its IUPAC name is 4-[2,5-bis(4-oxo-1-adamantyl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate.
| Compound Name | 4-[2,5-bis(4-oxo-1-adamantyl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
|---|---|
| PubChem CID | 176603591 |
| Molecular Formula | C33H29F4O7S- |
| Molecular Weight | 645.65 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 4-[2,5-bis(4-oxo-1-adamantyl)benzoyl]oxy-2,3,5,6-tetrafluorobenzenesulfonate |
| SMILES | O=C(Oc1c(F)c(F)c(S(=O)(=O)[O-])c(F)c1F)c1cc(C23CC4CC(C2)C(=O)C(C4)C3)ccc1C12CC3CC(C1)C(=O)C(C3)C2 |
| InChI | InChI=1S/C33H30F4O7S/c34-23-25(36)30(45(41,42)43)26(37)24(35)29(23)44-31(40)21-7-20(32-8-14-3-16(10-32)27(38)17(4-14)11-32)1-2-22(21)33-9-15-5-18(12-33)28(39)19(6-15)13-33/h1-2,7,14-19H,3-6,8-13H2,(H,41,42,43)/p-1 |
| InChIKey | YLYWBZAXMDMWCJ-UHFFFAOYSA-M |
| XLogP | 5.66 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.65 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|