C11H20O3 — CID 176605139
2-(3-ethenoxypropyl)-2-ethyl-1,4-dioxane (PubChem CID 176605139) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-(3-ethenoxypropyl)-2-ethyl-1,4-dioxane.
| Compound Name | 2-(3-ethenoxypropyl)-2-ethyl-1,4-dioxane |
|---|---|
| PubChem CID | 176605139 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 2-(3-ethenoxypropyl)-2-ethyl-1,4-dioxane |
| SMILES | C=COCCCC1(CC)COCCO1 |
| InChI | InChI=1S/C11H20O3/c1-3-11(6-5-7-12-4-2)10-13-8-9-14-11/h4H,2-3,5-10H2,1H3 |
| InChIKey | FSTZNVZPMKLNTP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|