C10H18O3 — CID 163571112
4-ethenoxy-5-methoxy-2,3-dimethyloxane (PubChem CID 163571112) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is 4-ethenoxy-5-methoxy-2,3-dimethyloxane.
| Compound Name | 4-ethenoxy-5-methoxy-2,3-dimethyloxane |
|---|---|
| PubChem CID | 163571112 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4-ethenoxy-5-methoxy-2,3-dimethyloxane |
| SMILES | C=COC1C(OC)COC(C)C1C |
| InChI | InChI=1S/C10H18O3/c1-5-12-10-7(2)8(3)13-6-9(10)11-4/h5,7-10H,1,6H2,2-4H3 |
| InChIKey | FZKKWFIAGSGNPX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|